C37H36F6O4 — CID 134273661
2-[4-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenoxy]butyl]-6-[4-(4-ethoxy-2,3-difluorophenyl)-3-fluorophenoxy]hexanal (PubChem CID 134273661) has the molecular formula C37H36F6O4 and a molecular weight of 658.68 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenoxy]butyl]-6-[4-(4-ethoxy-2,3-difluorophenyl)-3-fluorophenoxy]hexanal.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenoxy]butyl]-6-[4-(4-ethoxy-2,3-difluorophenyl)-3-fluorophenoxy]hexanal |
|---|---|
| PubChem CID | 134273661 |
| Molecular Formula | C37H36F6O4 |
| Molecular Weight | 658.68 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-methylphenyl)-3-fluorophenoxy]butyl]-6-[4-(4-ethoxy-2,3-difluorophenyl)-3-fluorophenoxy]hexanal |
| SMILES | CCOc1ccc(-c2ccc(OCCCCC(C=O)CCCCOc3ccc(-c4ccc(C)c(F)c4F)c(F)c3)cc2F)c(F)c1F |
| InChI | InChI=1S/C37H36F6O4/c1-3-45-33-17-16-30(36(42)37(33)43)28-15-12-26(21-32(28)39)47-19-7-5-9-24(22-44)8-4-6-18-46-25-11-14-27(31(38)20-25)29-13-10-23(2)34(40)35(29)41/h10-17,20-22,24H,3-9,18-19H2,1-2H3 |
| InChIKey | JEMDLNVIJOHXLI-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.68 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|