C22H19F3N2O2 — CID 58141516
2-(4-but-3-enoxy-2-fluorophenyl)-5-[(2,3-difluoro-4-methylphenoxy)methyl]pyrimidine (PubChem CID 58141516) has the molecular formula C22H19F3N2O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-(4-but-3-enoxy-2-fluorophenyl)-5-[(2,3-difluoro-4-methylphenoxy)methyl]pyrimidine.
| Compound Name | 2-(4-but-3-enoxy-2-fluorophenyl)-5-[(2,3-difluoro-4-methylphenoxy)methyl]pyrimidine |
|---|---|
| PubChem CID | 58141516 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(4-but-3-enoxy-2-fluorophenyl)-5-[(2,3-difluoro-4-methylphenoxy)methyl]pyrimidine |
| SMILES | C=CCCOc1ccc(-c2ncc(COc3ccc(C)c(F)c3F)cn2)c(F)c1 |
| InChI | InChI=1S/C22H19F3N2O2/c1-3-4-9-28-16-6-7-17(18(23)10-16)22-26-11-15(12-27-22)13-29-19-8-5-14(2)20(24)21(19)25/h3,5-8,10-12H,1,4,9,13H2,2H3 |
| InChIKey | LNEQDVCEXVPJCV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|