C23H21F3N2O — CID 58141786
2-(4-but-3-enoxy-2-fluorophenyl)-5-[2-(2,3-difluoro-4-methylphenyl)ethyl]pyrimidine (PubChem CID 58141786) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-(4-but-3-enoxy-2-fluorophenyl)-5-[2-(2,3-difluoro-4-methylphenyl)ethyl]pyrimidine.
| Compound Name | 2-(4-but-3-enoxy-2-fluorophenyl)-5-[2-(2,3-difluoro-4-methylphenyl)ethyl]pyrimidine |
|---|---|
| PubChem CID | 58141786 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-(4-but-3-enoxy-2-fluorophenyl)-5-[2-(2,3-difluoro-4-methylphenyl)ethyl]pyrimidine |
| SMILES | C=CCCOc1ccc(-c2ncc(CCc3ccc(C)c(F)c3F)cn2)c(F)c1 |
| InChI | InChI=1S/C23H21F3N2O/c1-3-4-11-29-18-9-10-19(20(24)12-18)23-27-13-16(14-28-23)6-8-17-7-5-15(2)21(25)22(17)26/h3,5,7,9-10,12-14H,1,4,6,8,11H2,2H3 |
| InChIKey | HJAJEMAVKWKIBZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|