C32H28F4O2 — CID 89429977
1-but-3-enoxy-4-[4-[2-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]ethyl]phenyl]-2,3-difluorobenzene (PubChem CID 89429977) has the molecular formula C32H28F4O2 and a molecular weight of 520.57 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[4-[2-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]ethyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-but-3-enoxy-4-[4-[2-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]ethyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89429977 |
| Molecular Formula | C32H28F4O2 |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 1-but-3-enoxy-4-[4-[2-[4-(4-ethoxyphenyl)-2,3-difluorophenyl]ethyl]phenyl]-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(-c2ccc(CCc3ccc(-c4ccc(OCC)cc4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C32H28F4O2/c1-3-5-20-38-28-19-18-27(31(35)32(28)36)22-9-6-21(7-10-22)8-11-24-14-17-26(30(34)29(24)33)23-12-15-25(16-13-23)37-4-2/h3,6-7,9-10,12-19H,1,4-5,8,11,20H2,2H3 |
| InChIKey | UYIQEYGDKGWRJP-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|