C32H27F3O2 — CID 89429766
1-[(E)-2-[4-(4-but-3-enoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene (PubChem CID 89429766) has the molecular formula C32H27F3O2 and a molecular weight of 500.56 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-but-3-enoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene.
| Compound Name | 1-[(E)-2-[4-(4-but-3-enoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89429766 |
| Molecular Formula | C32H27F3O2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-[(E)-2-[4-(4-but-3-enoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene |
| SMILES | C=CCCOc1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(OCC)cc4)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C32H27F3O2/c1-3-5-20-37-30-19-15-26(21-29(30)33)23-9-6-22(7-10-23)8-11-25-14-18-28(32(35)31(25)34)24-12-16-27(17-13-24)36-4-2/h3,6-19,21H,1,4-5,20H2,2H3/b11-8+ |
| InChIKey | CMHBEMJEBOTXRK-DHZHZOJOSA-N |
| XLogP | 8.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|