C34H33F3O2 — CID 89429683
1-[(E)-2-[4-(4-butoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-butoxyphenyl)-2,3-difluorobenzene (PubChem CID 89429683) has the molecular formula C34H33F3O2 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-butoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-butoxyphenyl)-2,3-difluorobenzene.
| Compound Name | 1-[(E)-2-[4-(4-butoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-butoxyphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89429683 |
| Molecular Formula | C34H33F3O2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 1-[(E)-2-[4-(4-butoxy-3-fluorophenyl)phenyl]ethenyl]-4-(4-butoxyphenyl)-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(OCCCC)c(F)c4)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C34H33F3O2/c1-3-5-21-38-29-17-13-26(14-18-29)30-19-15-27(33(36)34(30)37)12-9-24-7-10-25(11-8-24)28-16-20-32(31(35)23-28)39-22-6-4-2/h7-20,23H,3-6,21-22H2,1-2H3/b12-9+ |
| InChIKey | YPUPQWMTIJPLRO-FMIVXFBMSA-N |
| XLogP | 9.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|