C33H36F4O2 — CID 89430182
1-butoxy-4-[(E)-2-[4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]phenyl]ethenyl]-2,3-difluorobenzene (PubChem CID 89430182) has the molecular formula C33H36F4O2 and a molecular weight of 540.64 g/mol. Its IUPAC name is 1-butoxy-4-[(E)-2-[4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]phenyl]ethenyl]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[(E)-2-[4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]phenyl]ethenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430182 |
| Molecular Formula | C33H36F4O2 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 1-butoxy-4-[(E)-2-[4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]phenyl]ethenyl]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(/C=C/c2ccc(-c3ccc(C4CCC(OCCC)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C33H36F4O2/c1-3-5-21-39-29-19-14-25(30(34)33(29)37)11-8-22-6-9-23(10-7-22)27-17-18-28(32(36)31(27)35)24-12-15-26(16-13-24)38-20-4-2/h6-11,14,17-19,24,26H,3-5,12-13,15-16,20-21H2,1-2H3/b11-8+ |
| InChIKey | NFHVYPCUCULHJF-DHZHZOJOSA-N |
| XLogP | 9.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|