C29H28F4O2 — CID 77470844
[4-[4-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]methanol (PubChem CID 77470844) has the molecular formula C29H28F4O2 and a molecular weight of 484.53 g/mol. Its IUPAC name is [4-[4-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]methanol.
| Compound Name | [4-[4-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 77470844 |
| Molecular Formula | C29H28F4O2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [4-[4-[4-[2-(4-ethoxy-2,3-difluorophenyl)ethenyl]phenyl]-2,3-difluorophenyl]cyclohexyl]methanol |
| SMILES | CCOc1ccc(C=Cc2ccc(-c3ccc(C4CCC(CO)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C29H28F4O2/c1-2-35-25-16-13-22(26(30)29(25)33)12-5-18-3-8-20(9-4-18)23-14-15-24(28(32)27(23)31)21-10-6-19(17-34)7-11-21/h3-5,8-9,12-16,19,21,34H,2,6-7,10-11,17H2,1H3 |
| InChIKey | LKZHUTUMSQOWIG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|