C27H26F4O — CID 58141764
1-[(E)-2-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]ethenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 58141764) has the molecular formula C27H26F4O and a molecular weight of 442.50 g/mol. Its IUPAC name is 1-[(E)-2-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]ethenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[(E)-2-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]ethenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 58141764 |
| Molecular Formula | C27H26F4O |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-[(E)-2-[4-(2,3-difluoro-4-hexoxyphenyl)phenyl]ethenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(/C=C/c3ccc(C)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C27H26F4O/c1-3-4-5-6-17-32-23-16-15-22(26(30)27(23)31)20-12-8-19(9-13-20)10-14-21-11-7-18(2)24(28)25(21)29/h7-16H,3-6,17H2,1-2H3/b14-10+ |
| InChIKey | JLHCYZSQNYYVPM-GXDHUFHOSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|