C23H19F3O2 — CID 76658350
[4-[2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorophenyl]methanol (PubChem CID 76658350) has the molecular formula C23H19F3O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is [4-[2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorophenyl]methanol.
| Compound Name | [4-[2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorophenyl]methanol |
|---|---|
| PubChem CID | 76658350 |
| Molecular Formula | C23H19F3O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [4-[2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorophenyl]methanol |
| SMILES | CCOc1ccc(-c2ccc(C=Cc3ccc(CO)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C23H19F3O2/c1-2-28-21-12-11-18(13-20(21)24)16-6-3-15(4-7-16)5-8-17-9-10-19(14-27)23(26)22(17)25/h3-13,27H,2,14H2,1H3 |
| InChIKey | FUXMGMIEGPRNKK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|