C24H20F4O2 — CID 89139958
1-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-4-(ethoxymethyl)-2,3-difluorobenzene (PubChem CID 89139958) has the molecular formula C24H20F4O2 and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-4-(ethoxymethyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-4-(ethoxymethyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89139958 |
| Molecular Formula | C24H20F4O2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-4-(ethoxymethyl)-2,3-difluorobenzene |
| SMILES | CCOCc1ccc(-c2ccc(/C=C/c3ccc(OC)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C24H20F4O2/c1-3-30-14-18-10-12-19(23(27)22(18)26)16-7-4-15(5-8-16)6-9-17-11-13-20(29-2)24(28)21(17)25/h4-13H,3,14H2,1-2H3/b9-6+ |
| InChIKey | VPVIUNGFUIVPRI-RMKNXTFCSA-N |
| XLogP | 6.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|