C30H25F3O2 — CID 89124833
1-[(E)-2-[4-[4-(ethoxymethyl)-2-fluorophenyl]phenyl]ethenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene (PubChem CID 89124833) has the molecular formula C30H25F3O2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-[(E)-2-[4-[4-(ethoxymethyl)-2-fluorophenyl]phenyl]ethenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene.
| Compound Name | 1-[(E)-2-[4-[4-(ethoxymethyl)-2-fluorophenyl]phenyl]ethenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 89124833 |
| Molecular Formula | C30H25F3O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-[(E)-2-[4-[4-(ethoxymethyl)-2-fluorophenyl]phenyl]ethenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene |
| SMILES | CCOCc1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(OC)cc4)c(F)c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C30H25F3O2/c1-3-35-19-21-7-16-26(28(31)18-21)22-8-4-20(5-9-22)6-10-24-13-17-27(30(33)29(24)32)23-11-14-25(34-2)15-12-23/h4-18H,3,19H2,1-2H3/b10-6+ |
| InChIKey | BXWGONDSHNSHLJ-UXBLZVDNSA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|