C31H26F4 — CID 77470915
1-[2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]phenyl]ethenyl]-4-ethyl-2,3-difluorobenzene (PubChem CID 77470915) has the molecular formula C31H26F4 and a molecular weight of 474.54 g/mol. Its IUPAC name is 1-[2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]phenyl]ethenyl]-4-ethyl-2,3-difluorobenzene.
| Compound Name | 1-[2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]phenyl]ethenyl]-4-ethyl-2,3-difluorobenzene |
|---|---|
| PubChem CID | 77470915 |
| Molecular Formula | C31H26F4 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[2-[4-[2,3-difluoro-4-(4-propylphenyl)phenyl]phenyl]ethenyl]-4-ethyl-2,3-difluorobenzene |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(C=Cc4ccc(CC)c(F)c4F)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H26F4/c1-3-5-20-6-11-23(12-7-20)26-18-19-27(31(35)30(26)34)24-13-8-21(9-14-24)10-15-25-17-16-22(4-2)28(32)29(25)33/h6-19H,3-5H2,1-2H3 |
| InChIKey | UMYVLVBNJAOOBP-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|