C23H16F4O2 — CID 88997622
2-[4-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88997622) has the molecular formula C23H16F4O2 and a molecular weight of 400.37 g/mol. Its IUPAC name is 2-[4-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88997622 |
| Molecular Formula | C23H16F4O2 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[4-[4-[(E)-2-(2,3-difluoro-4-methoxyphenyl)ethenyl]phenyl]-2,3-difluorophenyl]oxirane |
| SMILES | COc1ccc(/C=C/c2ccc(-c3ccc(C4CO4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C23H16F4O2/c1-28-18-11-8-15(20(24)23(18)27)7-4-13-2-5-14(6-3-13)16-9-10-17(19-12-29-19)22(26)21(16)25/h2-11,19H,12H2,1H3/b7-4+ |
| InChIKey | CLXLKYRQJHIKOH-QPJJXVBHSA-N |
| XLogP | 6.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|