C22H17F3O — CID 159752648
1-[(E)-2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorobenzene (PubChem CID 159752648) has the molecular formula C22H17F3O and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorobenzene.
| Compound Name | 1-[(E)-2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 159752648 |
| Molecular Formula | C22H17F3O |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[(E)-2-[4-(4-ethoxy-3-fluorophenyl)phenyl]ethenyl]-2,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2ccc(/C=C/c3cccc(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C22H17F3O/c1-2-26-21-13-12-18(14-20(21)24)16-9-6-15(7-10-16)8-11-17-4-3-5-19(23)22(17)25/h3-14H,2H2,1H3/b11-8+ |
| InChIKey | NDVNDNNHHMKFLR-DHZHZOJOSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|