C30H24F4O3 — CID 143908952
4-[4-[4-[(2,3-difluoro-4-pent-4-enoxyphenyl)methoxy]phenyl]-2,3-difluorophenyl]phenol (PubChem CID 143908952) has the molecular formula C30H24F4O3 and a molecular weight of 508.51 g/mol. Its IUPAC name is 4-[4-[4-[(2,3-difluoro-4-pent-4-enoxyphenyl)methoxy]phenyl]-2,3-difluorophenyl]phenol.
| Compound Name | 4-[4-[4-[(2,3-difluoro-4-pent-4-enoxyphenyl)methoxy]phenyl]-2,3-difluorophenyl]phenol |
|---|---|
| PubChem CID | 143908952 |
| Molecular Formula | C30H24F4O3 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 4-[4-[4-[(2,3-difluoro-4-pent-4-enoxyphenyl)methoxy]phenyl]-2,3-difluorophenyl]phenol |
| SMILES | C=CCCCOc1ccc(COc2ccc(-c3ccc(-c4ccc(O)cc4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C30H24F4O3/c1-2-3-4-17-36-26-16-9-21(27(31)30(26)34)18-37-23-12-7-20(8-13-23)25-15-14-24(28(32)29(25)33)19-5-10-22(35)11-6-19/h2,5-16,35H,1,3-4,17-18H2 |
| InChIKey | IWHIHIXNORSWNG-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|