C32H30F4O3 — CID 89430006
1-butoxy-4-[4-[[2,3-difluoro-4-(4-propoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorobenzene (PubChem CID 89430006) has the molecular formula C32H30F4O3 and a molecular weight of 538.58 g/mol. Its IUPAC name is 1-butoxy-4-[4-[[2,3-difluoro-4-(4-propoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[4-[[2,3-difluoro-4-(4-propoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430006 |
| Molecular Formula | C32H30F4O3 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 1-butoxy-4-[4-[[2,3-difluoro-4-(4-propoxyphenyl)phenyl]methoxy]phenyl]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(-c2ccc(OCc3ccc(-c4ccc(OCCC)cc4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C32H30F4O3/c1-3-5-19-38-28-17-16-27(31(35)32(28)36)22-8-13-25(14-9-22)39-20-23-10-15-26(30(34)29(23)33)21-6-11-24(12-7-21)37-18-4-2/h6-17H,3-5,18-20H2,1-2H3 |
| InChIKey | UASXRPDPUDPPNA-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|