C31H34F4O3 — CID 89430551
1-(4-butoxycyclohexyl)-4-[4-[(4-ethoxy-2,3-difluorophenyl)methoxy]phenyl]-2,3-difluorobenzene (PubChem CID 89430551) has the molecular formula C31H34F4O3 and a molecular weight of 530.60 g/mol. Its IUPAC name is 1-(4-butoxycyclohexyl)-4-[4-[(4-ethoxy-2,3-difluorophenyl)methoxy]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-butoxycyclohexyl)-4-[4-[(4-ethoxy-2,3-difluorophenyl)methoxy]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430551 |
| Molecular Formula | C31H34F4O3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 1-(4-butoxycyclohexyl)-4-[4-[(4-ethoxy-2,3-difluorophenyl)methoxy]phenyl]-2,3-difluorobenzene |
| SMILES | CCCCOC1CCC(c2ccc(-c3ccc(OCc4ccc(OCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C31H34F4O3/c1-3-5-18-37-23-11-6-20(7-12-23)25-15-16-26(30(34)29(25)33)21-8-13-24(14-9-21)38-19-22-10-17-27(36-4-2)31(35)28(22)32/h8-10,13-17,20,23H,3-7,11-12,18-19H2,1-2H3 |
| InChIKey | WVFLAWJNLXWFMZ-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|