C32H31F3O3 — CID 89429715
1-[[4-(4-butoxy-2-fluorophenyl)phenyl]methoxy]-2,3-difluoro-4-(4-propoxyphenyl)benzene (PubChem CID 89429715) has the molecular formula C32H31F3O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is 1-[[4-(4-butoxy-2-fluorophenyl)phenyl]methoxy]-2,3-difluoro-4-(4-propoxyphenyl)benzene.
| Compound Name | 1-[[4-(4-butoxy-2-fluorophenyl)phenyl]methoxy]-2,3-difluoro-4-(4-propoxyphenyl)benzene |
|---|---|
| PubChem CID | 89429715 |
| Molecular Formula | C32H31F3O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 1-[[4-(4-butoxy-2-fluorophenyl)phenyl]methoxy]-2,3-difluoro-4-(4-propoxyphenyl)benzene |
| SMILES | CCCCOc1ccc(-c2ccc(COc3ccc(-c4ccc(OCCC)cc4)c(F)c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C32H31F3O3/c1-3-5-19-37-26-14-15-27(29(33)20-26)23-8-6-22(7-9-23)21-38-30-17-16-28(31(34)32(30)35)24-10-12-25(13-11-24)36-18-4-2/h6-17,20H,3-5,18-19,21H2,1-2H3 |
| InChIKey | BWSMTRGZRPXHNG-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|