C18H22F2O2Si — CID 122393627
4-[2,3-difluoro-4-(3-trimethylsilylpropoxy)phenyl]phenol (PubChem CID 122393627) has the molecular formula C18H22F2O2Si and a molecular weight of 336.45 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-(3-trimethylsilylpropoxy)phenyl]phenol.
| Compound Name | 4-[2,3-difluoro-4-(3-trimethylsilylpropoxy)phenyl]phenol |
|---|---|
| PubChem CID | 122393627 |
| Molecular Formula | C18H22F2O2Si |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[2,3-difluoro-4-(3-trimethylsilylpropoxy)phenyl]phenol |
| SMILES | C[Si](C)(C)CCCOc1ccc(-c2ccc(O)cc2)c(F)c1F |
| InChI | InChI=1S/C18H22F2O2Si/c1-23(2,3)12-4-11-22-16-10-9-15(17(19)18(16)20)13-5-7-14(21)8-6-13/h5-10,21H,4,11-12H2,1-3H3 |
| InChIKey | OBTQUJCREBYYDB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|