C21H20F5O3P — CID 166583520
2,3-difluoro-1-(4-pent-4-enoxyphenyl)-4-[(2R)-3,3,3-trifluoro-2-(phosphorosomethyl)propoxy]benzene (PubChem CID 166583520) has the molecular formula C21H20F5O3P and a molecular weight of 446.35 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-pent-4-enoxyphenyl)-4-[(2R)-3,3,3-trifluoro-2-(phosphorosomethyl)propoxy]benzene.
| Compound Name | 2,3-difluoro-1-(4-pent-4-enoxyphenyl)-4-[(2R)-3,3,3-trifluoro-2-(phosphorosomethyl)propoxy]benzene |
|---|---|
| PubChem CID | 166583520 |
| Molecular Formula | C21H20F5O3P |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2,3-difluoro-1-(4-pent-4-enoxyphenyl)-4-[(2R)-3,3,3-trifluoro-2-(phosphorosomethyl)propoxy]benzene |
| SMILES | C=CCCCOc1ccc(-c2ccc(OC[C@@H](CP=O)C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H20F5O3P/c1-2-3-4-11-28-16-7-5-14(6-8-16)17-9-10-18(20(23)19(17)22)29-12-15(13-30-27)21(24,25)26/h2,5-10,15H,1,3-4,11-13H2/t15-/m0/s1 |
| InChIKey | FCFSAHFYKICNOP-HNNXBMFYSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|