C24H22F2O — CID 69030505
2,3-difluoro-1-methyl-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene (PubChem CID 69030505) has the molecular formula C24H22F2O and a molecular weight of 364.44 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene.
| Compound Name | 2,3-difluoro-1-methyl-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 69030505 |
| Molecular Formula | C24H22F2O |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[4-(4-pent-4-enoxyphenyl)phenyl]benzene |
| SMILES | C=CCCCOc1ccc(-c2ccc(-c3ccc(C)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C24H22F2O/c1-3-4-5-16-27-21-13-11-19(12-14-21)18-7-9-20(10-8-18)22-15-6-17(2)23(25)24(22)26/h3,6-15H,1,4-5,16H2,2H3 |
| InChIKey | SDHSLSJAPYGNOL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|