C25H20F2 — CID 139764850
1-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 139764850) has the molecular formula C25H20F2 and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 139764850 |
| Molecular Formula | C25H20F2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(-c3ccc(C)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C25H20F2/c1-3-4-5-19-7-9-20(10-8-19)11-12-21-13-15-22(16-14-21)23-17-6-18(2)24(26)25(23)27/h3,6-10,13-17H,1,4-5H2,2H3 |
| InChIKey | COGNRFCTFRKZOQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|