C26H18F4N2O — CID 143773181
2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-methylpyrimidine (PubChem CID 143773181) has the molecular formula C26H18F4N2O and a molecular weight of 450.44 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-methylpyrimidine.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 143773181 |
| Molecular Formula | C26H18F4N2O |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2,3-difluorophenyl]-5-methylpyrimidine |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(-c4ncc(C)cn4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C26H18F4N2O/c1-3-12-33-21-11-10-19(23(28)25(21)30)17-6-4-16(5-7-17)18-8-9-20(24(29)22(18)27)26-31-13-15(2)14-32-26/h3-11,13-14H,1,12H2,2H3 |
| InChIKey | FFRWSKJIERAENN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|