C28H27F3O3 — CID 89045928
5-[(2Z,4E)-6-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-fluorohepta-2,4,6-trien-3-yl]-2-ethenyl-1,3-dioxane (PubChem CID 89045928) has the molecular formula C28H27F3O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 5-[(2Z,4E)-6-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-fluorohepta-2,4,6-trien-3-yl]-2-ethenyl-1,3-dioxane.
| Compound Name | 5-[(2Z,4E)-6-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-fluorohepta-2,4,6-trien-3-yl]-2-ethenyl-1,3-dioxane |
|---|---|
| PubChem CID | 89045928 |
| Molecular Formula | C28H27F3O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 5-[(2Z,4E)-6-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-fluorohepta-2,4,6-trien-3-yl]-2-ethenyl-1,3-dioxane |
| SMILES | C=CCOc1ccc(-c2ccc(C(=C)/C(F)=C\C(=C/C)C3COC(C=C)OC3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H27F3O3/c1-5-14-32-25-13-12-23(27(30)28(25)31)21-10-8-20(9-11-21)18(4)24(29)15-19(6-2)22-16-33-26(7-3)34-17-22/h5-13,15,22,26H,1,3-4,14,16-17H2,2H3/b19-6+,24-15+ |
| InChIKey | MNCOEAQTRYXQMR-HXZUQNEASA-N |
| XLogP | 7.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|