C28H29F3O4 — CID 89045861
1-[5-[(2E,4E)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2-fluorohepta-2,4,6-trienyl]-1,3-dioxan-2-yl]ethanol (PubChem CID 89045861) has the molecular formula C28H29F3O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is 1-[5-[(2E,4E)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2-fluorohepta-2,4,6-trienyl]-1,3-dioxan-2-yl]ethanol.
| Compound Name | 1-[5-[(2E,4E)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2-fluorohepta-2,4,6-trienyl]-1,3-dioxan-2-yl]ethanol |
|---|---|
| PubChem CID | 89045861 |
| Molecular Formula | C28H29F3O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[5-[(2E,4E)-4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-2-fluorohepta-2,4,6-trienyl]-1,3-dioxan-2-yl]ethanol |
| SMILES | C=C/C=C(\C=C(\F)CC1COC(C(C)O)OC1)c1ccc(-c2ccc(OCC=C)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H29F3O4/c1-4-6-22(15-23(29)14-19-16-34-28(18(3)32)35-17-19)20-7-9-21(10-8-20)24-11-12-25(33-13-5-2)27(31)26(24)30/h4-12,15,18-19,28,32H,1-2,13-14,16-17H2,3H3/b22-6+,23-15+ |
| InChIKey | VAYWEVJFHVIWNW-TYRGJCLOSA-N |
| XLogP | 6.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|