C21H16F4N2O — CID 20621804
5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-prop-2-enylpyrimidine (PubChem CID 20621804) has the molecular formula C21H16F4N2O and a molecular weight of 388.36 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-prop-2-enylpyrimidine.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-prop-2-enylpyrimidine |
|---|---|
| PubChem CID | 20621804 |
| Molecular Formula | C21H16F4N2O |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2-prop-2-enylpyrimidine |
| SMILES | C=CCc1ncc(-c2ccc(-c3ccc(OCC)c(F)c3F)c(F)c2F)cn1 |
| InChI | InChI=1S/C21H16F4N2O/c1-3-5-17-26-10-12(11-27-17)13-6-7-14(19(23)18(13)22)15-8-9-16(28-4-2)21(25)20(15)24/h3,6-11H,1,4-5H2,2H3 |
| InChIKey | OKJRZYHGOZQWCB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|