C22H23F3O3 — CID 130282022
4-[[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexane-1-carbaldehyde (PubChem CID 130282022) has the molecular formula C22H23F3O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-[[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 130282022 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 4-[[4-(4-ethoxy-2-fluorophenyl)-2,3-difluorophenoxy]methyl]cyclohexane-1-carbaldehyde |
| SMILES | CCOc1ccc(-c2ccc(OCC3CCC(C=O)CC3)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C22H23F3O3/c1-2-27-16-7-8-17(19(23)11-16)18-9-10-20(22(25)21(18)24)28-13-15-5-3-14(12-26)4-6-15/h7-12,14-15H,2-6,13H2,1H3 |
| InChIKey | NRXBSBOCSNJDPE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|