C13H14F4O2 — CID 153282338
1-(2,2-difluorobutoxy)-2,3-difluoro-4-prop-2-enoxybenzene (PubChem CID 153282338) has the molecular formula C13H14F4O2 and a molecular weight of 278.25 g/mol. Its IUPAC name is 1-(2,2-difluorobutoxy)-2,3-difluoro-4-prop-2-enoxybenzene.
| Compound Name | 1-(2,2-difluorobutoxy)-2,3-difluoro-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 153282338 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(2,2-difluorobutoxy)-2,3-difluoro-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(OCC(F)(F)CC)c(F)c1F |
| InChI | InChI=1S/C13H14F4O2/c1-3-7-18-9-5-6-10(12(15)11(9)14)19-8-13(16,17)4-2/h3,5-6H,1,4,7-8H2,2H3 |
| InChIKey | XMEHBDXJRGNFNP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|