C10H9F5O2 — CID 158664029
1-ethoxy-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 158664029) has the molecular formula C10H9F5O2 and a molecular weight of 256.17 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 158664029 |
| Molecular Formula | C10H9F5O2 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CCOc1ccc(OCC(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H9F5O2/c1-2-16-6-3-4-7(9(12)8(6)11)17-5-10(13,14)15/h3-4H,2,5H2,1H3 |
| InChIKey | PJCGXEJJYKPPQD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |