C11H15FO3 — CID 164895475
(3,6-diethoxy-2-fluorophenyl)methanol (PubChem CID 164895475) has the molecular formula C11H15FO3 and a molecular weight of 214.24 g/mol. Its IUPAC name is (3,6-diethoxy-2-fluorophenyl)methanol.
| Compound Name | (3,6-diethoxy-2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 164895475 |
| Molecular Formula | C11H15FO3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (3,6-diethoxy-2-fluorophenyl)methanol |
| SMILES | CCOc1ccc(OCC)c(CO)c1F |
| InChI | InChI=1S/C11H15FO3/c1-3-14-9-5-6-10(15-4-2)11(12)8(9)7-13/h5-6,13H,3-4,7H2,1-2H3 |
| InChIKey | SZCVYFUWIVOBHG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |