C9H9F2NO — CID 130242678
(4-ethoxy-2,3-difluorophenyl)methanimine (PubChem CID 130242678) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is (4-ethoxy-2,3-difluorophenyl)methanimine.
| Compound Name | (4-ethoxy-2,3-difluorophenyl)methanimine |
|---|---|
| PubChem CID | 130242678 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (4-ethoxy-2,3-difluorophenyl)methanimine |
| SMILES | [H]/N=C/c1ccc(OCC)c(F)c1F |
| InChI | InChI=1S/C9H9F2NO/c1-2-13-7-4-3-6(5-12)8(10)9(7)11/h3-5,12H,2H2,1H3/b12-5+ |
| InChIKey | HBGUUMFXGRVYEB-LFYBBSHMSA-N |
| XLogP | 2.36 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|