C11H14F2O — CID 58402522
1-ethoxy-2,4-difluoro-3-propan-2-ylbenzene (PubChem CID 58402522) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-ethoxy-2,4-difluoro-3-propan-2-ylbenzene.
| Compound Name | 1-ethoxy-2,4-difluoro-3-propan-2-ylbenzene |
|---|---|
| PubChem CID | 58402522 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-ethoxy-2,4-difluoro-3-propan-2-ylbenzene |
| SMILES | CCOc1ccc(F)c(C(C)C)c1F |
| InChI | InChI=1S/C11H14F2O/c1-4-14-9-6-5-8(12)10(7(2)3)11(9)13/h5-7H,4H2,1-3H3 |
| InChIKey | KXROFGRYKZSKHF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |