C12H10F2OSe — CID 59456301
2-(4-ethoxy-2,3-difluorophenyl)selenophene (PubChem CID 59456301) has the molecular formula C12H10F2OSe and a molecular weight of 287.17 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-difluorophenyl)selenophene.
| Compound Name | 2-(4-ethoxy-2,3-difluorophenyl)selenophene |
|---|---|
| PubChem CID | 59456301 |
| Molecular Formula | C12H10F2OSe |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-(4-ethoxy-2,3-difluorophenyl)selenophene |
| SMILES | CCOc1ccc(-c2ccc[se]2)c(F)c1F |
| InChI | InChI=1S/C12H10F2OSe/c1-2-15-9-6-5-8(11(13)12(9)14)10-4-3-7-16-10/h3-7H,2H2,1H3 |
| InChIKey | FILCPQBCXLNTLO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|