C39H34F4O2Se2 — CID 159572686
2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-methylselenophene;2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]selenophene (PubChem CID 159572686) has the molecular formula C39H34F4O2Se2 and a molecular weight of 768.61 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-methylselenophene;2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]selenophene.
| Compound Name | 2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-methylselenophene;2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]selenophene |
|---|---|
| PubChem CID | 159572686 |
| Molecular Formula | C39H34F4O2Se2 |
| Molecular Weight | 768.61 g/mol |
| Exact Mass | 770.08 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-methylselenophene;2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]selenophene |
| SMILES | CCCOc1ccc(-c2ccc(-c3ccc(C)[se]3)cc2)c(F)c1F.CCCOc1ccc(-c2ccc(-c3ccc[se]3)cc2)c(F)c1F |
| InChI | InChI=1S/C20H18F2OSe.C19H16F2OSe/c1-3-12-23-17-10-9-16(19(21)20(17)22)14-5-7-15(8-6-14)18-11-4-13(2)24-18;1-2-11-22-16-10-9-15(18(20)19(16)21)13-5-7-14(8-6-13)17-4-3-12-23-17/h4-11H,3,12H2,1-2H3;3-10,12H,2,11H2,1H3 |
| InChIKey | MIACXHYNPJFXMX-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.61 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|