C15H12F4O — CID 134386235
1-(3,4-difluorophenyl)-2,3-difluoro-4-propoxybenzene (PubChem CID 134386235) has the molecular formula C15H12F4O and a molecular weight of 284.25 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-(3,4-difluorophenyl)-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 134386235 |
| Molecular Formula | C15H12F4O |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2,3-difluoro-4-propoxybenzene |
| SMILES | CCCOc1ccc(-c2ccc(F)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C15H12F4O/c1-2-7-20-13-6-4-10(14(18)15(13)19)9-3-5-11(16)12(17)8-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | HTIVKZWTJRRZSP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |