C20H16F2O2S — CID 143775739
5-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]thiophene-2-carbaldehyde (PubChem CID 143775739) has the molecular formula C20H16F2O2S and a molecular weight of 358.41 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 143775739 |
| Molecular Formula | C20H16F2O2S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]thiophene-2-carbaldehyde |
| SMILES | CCCOc1ccc(-c2ccc(-c3ccc(C=O)s3)cc2)c(F)c1F |
| InChI | InChI=1S/C20H16F2O2S/c1-2-11-24-17-9-8-16(19(21)20(17)22)13-3-5-14(6-4-13)18-10-7-15(12-23)25-18/h3-10,12H,2,11H2,1H3 |
| InChIKey | URKQYUWADJLCEF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|