C23H26F2O — CID 134358545
1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-propoxybenzene (PubChem CID 134358545) has the molecular formula C23H26F2O and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 134358545 |
| Molecular Formula | C23H26F2O |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-propoxybenzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OCCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C23H26F2O/c1-3-15-26-21-14-13-20(22(24)23(21)25)19-11-9-18(10-12-19)17-7-5-16(4-2)6-8-17/h4,9-14,16-17H,2-3,5-8,15H2,1H3 |
| InChIKey | IAPWQPWIWPGTMH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|