C34H38F2O2 — CID 58021212
5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]-2-(4-ethenylcyclohexyl)oxane (PubChem CID 58021212) has the molecular formula C34H38F2O2 and a molecular weight of 516.67 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]-2-(4-ethenylcyclohexyl)oxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]-2-(4-ethenylcyclohexyl)oxane |
|---|---|
| PubChem CID | 58021212 |
| Molecular Formula | C34H38F2O2 |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]-2-(4-ethenylcyclohexyl)oxane |
| SMILES | C=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCCC)c(F)c5F)cc4)cc3)CO2)CC1 |
| InChI | InChI=1S/C34H38F2O2/c1-3-21-37-32-20-18-30(33(35)34(32)36)27-15-13-25(14-16-27)24-9-11-26(12-10-24)29-17-19-31(38-22-29)28-7-5-23(4-2)6-8-28/h4,9-16,18,20,23,28-29,31H,2-3,5-8,17,19,21-22H2,1H3 |
| InChIKey | DFRTYTFAPAVSFG-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|