C27H23F5O — CID 118858832
1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]benzene (PubChem CID 118858832) has the molecular formula C27H23F5O and a molecular weight of 458.47 g/mol. Its IUPAC name is 1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]benzene.
| Compound Name | 1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 118858832 |
| Molecular Formula | C27H23F5O |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-[4-(4-ethenylcyclohexyl)phenyl]-2,3-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]benzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OCc4cc(F)c(F)c(F)c4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C27H23F5O/c1-2-16-3-5-18(6-4-16)19-7-9-20(10-8-19)21-11-12-24(27(32)25(21)30)33-15-17-13-22(28)26(31)23(29)14-17/h2,7-14,16,18H,1,3-6,15H2 |
| InChIKey | RVGSZUFDTROXAT-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|