C22H22F2OS — CID 143775720
2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-propylthiophene (PubChem CID 143775720) has the molecular formula C22H22F2OS and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-propylthiophene.
| Compound Name | 2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-propylthiophene |
|---|---|
| PubChem CID | 143775720 |
| Molecular Formula | C22H22F2OS |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-5-propylthiophene |
| SMILES | CCCOc1ccc(-c2ccc(-c3ccc(CCC)s3)cc2)c(F)c1F |
| InChI | InChI=1S/C22H22F2OS/c1-3-5-17-10-13-20(26-17)16-8-6-15(7-9-16)18-11-12-19(25-14-4-2)22(24)21(18)23/h6-13H,3-5,14H2,1-2H3 |
| InChIKey | YLXIHCFZCVGSRR-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |