About 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene
1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene (PubChem CID 167433414) has the molecular formula C17H16F4OS
and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene |
| PubChem CID | 167433414 |
| Molecular Formula | C17H16F4OS |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCCSc1ccc(-c2ccc(OCC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H16F4OS/c1-3-9-23-13-8-6-11(15(19)17(13)21)10-5-7-12(22-4-2)16(20)14(10)18/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | SELQEDQCHSEUJD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene?
The IUPAC name of 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene (CID 167433414) is 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene.
What is the SMILES notation for 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene?
The canonical SMILES for 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene is CCCSc1ccc(-c2ccc(OCC)c(F)c2F)c(F)c1F.
What is the InChIKey of 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene?
The InChIKey is SELQEDQCHSEUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F4OS/c1-3-9-23-13-8-6-11(15(19)17(13)21)10-5-7-12(22-4-2)16(20)14(10)18/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene?
1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene has a molecular weight of 344.37 g/mol, XLogP of 5.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluoro-4-propylsulfanylphenyl)-4-ethoxy-2,3-difluorobenzene is sourced from PubChem (CID 167433414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).