C18H19F3O3 — CID 148736390
3-butoxy-6-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenol (PubChem CID 148736390) has the molecular formula C18H19F3O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-butoxy-6-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenol.
| Compound Name | 3-butoxy-6-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenol |
|---|---|
| PubChem CID | 148736390 |
| Molecular Formula | C18H19F3O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-butoxy-6-(4-ethoxy-2,3-difluorophenyl)-2-fluorophenol |
| SMILES | CCCCOc1ccc(-c2ccc(OCC)c(F)c2F)c(O)c1F |
| InChI | InChI=1S/C18H19F3O3/c1-3-5-10-24-14-9-7-12(18(22)17(14)21)11-6-8-13(23-4-2)16(20)15(11)19/h6-9,22H,3-5,10H2,1-2H3 |
| InChIKey | OBYXTBXJRGSGFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|