C22H26ClF3O2 — CID 125479169
1-butoxy-3-chloro-4-(2,3-difluoro-4-hexoxyphenyl)-2-fluorobenzene (PubChem CID 125479169) has the molecular formula C22H26ClF3O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is 1-butoxy-3-chloro-4-(2,3-difluoro-4-hexoxyphenyl)-2-fluorobenzene.
| Compound Name | 1-butoxy-3-chloro-4-(2,3-difluoro-4-hexoxyphenyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 125479169 |
| Molecular Formula | C22H26ClF3O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-butoxy-3-chloro-4-(2,3-difluoro-4-hexoxyphenyl)-2-fluorobenzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(OCCCC)c(F)c2Cl)c(F)c1F |
| InChI | InChI=1S/C22H26ClF3O2/c1-3-5-7-8-14-28-18-12-10-16(20(24)22(18)26)15-9-11-17(21(25)19(15)23)27-13-6-4-2/h9-12H,3-8,13-14H2,1-2H3 |
| InChIKey | YBVUZGNUQGEXKE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|