C22H25F3O3 — CID 134454116
6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-[2-(oxolan-2-yl)ethyl]phenol (PubChem CID 134454116) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is 6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-[2-(oxolan-2-yl)ethyl]phenol.
| Compound Name | 6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-[2-(oxolan-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 134454116 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-[2-(oxolan-2-yl)ethyl]phenol |
| SMILES | CCCCOc1ccc(-c2ccc(CCC3CCCO3)c(F)c2O)c(F)c1F |
| InChI | InChI=1S/C22H25F3O3/c1-2-3-12-28-18-11-10-16(20(24)21(18)25)17-9-7-14(19(23)22(17)26)6-8-15-5-4-13-27-15/h7,9-11,15,26H,2-6,8,12-13H2,1H3 |
| InChIKey | LKBOENBYXHTGQH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|