C11H16F2OSi — CID 15751975
(4-ethoxy-2,3-difluorophenyl)-trimethylsilane (PubChem CID 15751975) has the molecular formula C11H16F2OSi and a molecular weight of 230.33 g/mol. Its IUPAC name is (4-ethoxy-2,3-difluorophenyl)-trimethylsilane.
| Compound Name | (4-ethoxy-2,3-difluorophenyl)-trimethylsilane |
|---|---|
| PubChem CID | 15751975 |
| Molecular Formula | C11H16F2OSi |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (4-ethoxy-2,3-difluorophenyl)-trimethylsilane |
| SMILES | CCOc1ccc([Si](C)(C)C)c(F)c1F |
| InChI | InChI=1S/C11H16F2OSi/c1-5-14-8-6-7-9(15(2,3)4)11(13)10(8)12/h6-7H,5H2,1-4H3 |
| InChIKey | BQRKISWOADAHEY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|