C15H18F2OSi — CID 58151894
(3-ethoxy-5,6-difluoronaphthalen-2-yl)-trimethylsilane (PubChem CID 58151894) has the molecular formula C15H18F2OSi and a molecular weight of 280.39 g/mol. Its IUPAC name is (3-ethoxy-5,6-difluoronaphthalen-2-yl)-trimethylsilane.
| Compound Name | (3-ethoxy-5,6-difluoronaphthalen-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 58151894 |
| Molecular Formula | C15H18F2OSi |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3-ethoxy-5,6-difluoronaphthalen-2-yl)-trimethylsilane |
| SMILES | CCOc1cc2c(F)c(F)ccc2cc1[Si](C)(C)C |
| InChI | InChI=1S/C15H18F2OSi/c1-5-18-13-9-11-10(6-7-12(16)15(11)17)8-14(13)19(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | KKAPUHPUQUPUEQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|