C28H17F3O — CID 139857142
6-[2-[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene (PubChem CID 139857142) has the molecular formula C28H17F3O and a molecular weight of 426.44 g/mol. Its IUPAC name is 6-[2-[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139857142 |
| Molecular Formula | C28H17F3O |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 6-[2-[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2-difluoronaphthalene |
| SMILES | CCOc1ccc(C#Cc2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H17F3O/c1-2-32-24-13-7-19(8-14-24)3-4-21-6-11-22(27(30)18-21)10-5-20-9-15-25-23(17-20)12-16-26(29)28(25)31/h6-9,11-18H,2H2,1H3 |
| InChIKey | MEKKBSIPHDLFLJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|