C27H20F3NO — CID 139857957
2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]ethyl]-5-ethoxypyridine (PubChem CID 139857957) has the molecular formula C27H20F3NO and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]ethyl]-5-ethoxypyridine.
| Compound Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]ethyl]-5-ethoxypyridine |
|---|---|
| PubChem CID | 139857957 |
| Molecular Formula | C27H20F3NO |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]ethyl]-5-ethoxypyridine |
| SMILES | CCOc1ccc(CCc2ccc(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C27H20F3NO/c1-2-32-23-12-11-22(31-17-23)10-5-19-4-8-20(26(29)16-19)7-3-18-6-13-24-21(15-18)9-14-25(28)27(24)30/h4,6,8-9,11-17H,2,5,10H2,1H3 |
| InChIKey | JSGOPHKCRWPSFI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|