C20H10F6O — CID 139853793
6-[2-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethynyl]-1,2-difluoronaphthalene (PubChem CID 139853793) has the molecular formula C20H10F6O and a molecular weight of 380.29 g/mol. Its IUPAC name is 6-[2-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139853793 |
| Molecular Formula | C20H10F6O |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 6-[2-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethynyl]-1,2-difluoronaphthalene |
| SMILES | CCOc1c(F)c(F)c(C#Cc2ccc3c(F)c(F)ccc3c2)c(F)c1F |
| InChI | InChI=1S/C20H10F6O/c1-2-27-20-18(25)16(23)13(17(24)19(20)26)7-4-10-3-6-12-11(9-10)5-8-14(21)15(12)22/h3,5-6,8-9H,2H2,1H3 |
| InChIKey | FYMXIFSEVLNGKL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|